C21H24N4O4S2 — CID 30035073
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylsulfanyl-3-phenylimidazole-4-carboxamide (PubChem CID 30035073) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylsulfanyl-3-phenylimidazole-4-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylsulfanyl-3-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 30035073 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylsulfanyl-3-phenylimidazole-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)c2cnc(SC)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C21H24N4O4S2/c1-4-24(5-2)31(28,29)16-11-12-19(26)17(13-16)23-20(27)18-14-22-21(30-3)25(18)15-9-7-6-8-10-15/h6-14,26H,4-5H2,1-3H3,(H,23,27) |
| InChIKey | FMXGKBJRRORBDK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|