C21H22N4O4S2 — CID 30035066
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide (PubChem CID 30035066) has the molecular formula C21H22N4O4S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 30035066 |
| Molecular Formula | C21H22N4O4S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide |
| SMILES | CSc1ncc(C(=O)Nc2cc(S(=O)(=O)N3CCCC3)ccc2O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H22N4O4S2/c1-30-21-22-14-18(25(21)15-7-3-2-4-8-15)20(27)23-17-13-16(9-10-19(17)26)31(28,29)24-11-5-6-12-24/h2-4,7-10,13-14,26H,5-6,11-12H2,1H3,(H,23,27) |
| InChIKey | MBUQLGTXLCNCSR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|