C22H21F3N4O4S — CID 36765207
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 36765207) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 36765207 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(S(=O)(=O)N3CCCC3)ccc2O)cnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F3N4O4S/c1-14-18(13-26-29(14)16-6-4-5-15(11-16)22(23,24)25)21(31)27-19-12-17(7-8-20(19)30)34(32,33)28-9-2-3-10-28/h4-8,11-13,30H,2-3,9-10H2,1H3,(H,27,31) |
| InChIKey | LNPJTZJOESPVLY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|