C14H18N4OS — CID 116667442
4-amino-2-(tert-butylamino)-N-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 116667442) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-amino-2-(tert-butylamino)-N-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(tert-butylamino)-N-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116667442 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-amino-2-(tert-butylamino)-N-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)(C)Nc1nc(N)c(C(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C14H18N4OS/c1-14(2,3)18-13-17-11(15)10(20-13)12(19)16-9-7-5-4-6-8-9/h4-8H,15H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | TXLNPXPGQHYCGG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |