C15H20N4OS — CID 116668033
4-amino-N-benzyl-2-(tert-butylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116668033) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-amino-N-benzyl-2-(tert-butylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-benzyl-2-(tert-butylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116668033 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-amino-N-benzyl-2-(tert-butylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)(C)Nc1nc(N)c(C(=O)NCc2ccccc2)s1 |
| InChI | InChI=1S/C15H20N4OS/c1-15(2,3)19-14-18-12(16)11(21-14)13(20)17-9-10-7-5-4-6-8-10/h4-8H,9,16H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | ZPMNFGLDELGXLF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |