C11H12N4OS — CID 50741983
4-amino-2-(benzylamino)-1,3-thiazole-5-carboxamide (PubChem CID 50741983) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-amino-2-(benzylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(benzylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 50741983 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 4-amino-2-(benzylamino)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1sc(NCc2ccccc2)nc1N |
| InChI | InChI=1S/C11H12N4OS/c12-9-8(10(13)16)17-11(15-9)14-6-7-4-2-1-3-5-7/h1-5H,6,12H2,(H2,13,16)(H,14,15) |
| InChIKey | GKMPGGUYZNCZPO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |