C18H17N3OS — CID 71733211
[4-amino-2-(2-phenylethylamino)-1,3-thiazol-5-yl]-phenylmethanone (PubChem CID 71733211) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is [4-amino-2-(2-phenylethylamino)-1,3-thiazol-5-yl]-phenylmethanone.
| Compound Name | [4-amino-2-(2-phenylethylamino)-1,3-thiazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 71733211 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | [4-amino-2-(2-phenylethylamino)-1,3-thiazol-5-yl]-phenylmethanone |
| SMILES | Nc1nc(NCCc2ccccc2)sc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17N3OS/c19-17-16(15(22)14-9-5-2-6-10-14)23-18(21-17)20-12-11-13-7-3-1-4-8-13/h1-10H,11-12,19H2,(H,20,21) |
| InChIKey | KWDFURHLONLWRZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |