C14H14N2O3S — CID 106696786
5-acetyl-2-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 106696786) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-acetyl-2-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-acetyl-2-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106696786 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-acetyl-2-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)c1sc(NCCc2ccccc2)nc1C(=O)O |
| InChI | InChI=1S/C14H14N2O3S/c1-9(17)12-11(13(18)19)16-14(20-12)15-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | WOZAXUKGWZUVAP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |