C11H13F3N2O3S — CID 106697954
5-acetyl-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 106697954) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is 5-acetyl-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-acetyl-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106697954 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-acetyl-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)c1sc(NCCCCC(F)(F)F)nc1C(=O)O |
| InChI | InChI=1S/C11H13F3N2O3S/c1-6(17)8-7(9(18)19)16-10(20-8)15-5-3-2-4-11(12,13)14/h2-5H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | YOLFIRILCUQTPY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|