C13H19N3O4S — CID 106241485
ethyl 5-acetyl-2-[(5-amino-5-oxopentyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 106241485) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[(5-amino-5-oxopentyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[(5-amino-5-oxopentyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106241485 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl 5-acetyl-2-[(5-amino-5-oxopentyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NCCCCC(N)=O)sc1C(C)=O |
| InChI | InChI=1S/C13H19N3O4S/c1-3-20-12(19)10-11(8(2)17)21-13(16-10)15-7-5-4-6-9(14)18/h3-7H2,1-2H3,(H2,14,18)(H,15,16) |
| InChIKey | ZAJXHMKNDRBYEQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|