C11H17N3O5S2 — CID 107377433
ethyl 5-acetyl-2-(3-sulfamoylpropylamino)-1,3-thiazole-4-carboxylate (PubChem CID 107377433) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is ethyl 5-acetyl-2-(3-sulfamoylpropylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-acetyl-2-(3-sulfamoylpropylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 107377433 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | ethyl 5-acetyl-2-(3-sulfamoylpropylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NCCCS(N)(=O)=O)sc1C(C)=O |
| InChI | InChI=1S/C11H17N3O5S2/c1-3-19-10(16)8-9(7(2)15)20-11(14-8)13-5-4-6-21(12,17)18/h3-6H2,1-2H3,(H,13,14)(H2,12,17,18) |
| InChIKey | ISKLADODTCJGEC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|