C12H12N2O2S — CID 64631295
5-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631295) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 5-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64631295 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-(2-phenylethylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NCCc1ccccc1 |
| InChI | InChI=1S/C12H12N2O2S/c15-12(16)10-11(17-8-14-10)13-7-6-9-4-2-1-3-5-9/h1-5,8,13H,6-7H2,(H,15,16) |
| InChIKey | UTTLJEMKFRHAAP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |