C6H9N3O2S — CID 64631692
5-(2-aminoethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631692) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is 5-(2-aminoethylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(2-aminoethylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64631692 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 5-(2-aminoethylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | NCCNc1scnc1C(=O)O |
| InChI | InChI=1S/C6H9N3O2S/c7-1-2-8-5-4(6(10)11)9-3-12-5/h3,8H,1-2,7H2,(H,10,11) |
| InChIKey | XPBMRWFIEIVOGT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |