C11H18N2O2S — CID 115327010
5-(5-methylhexylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 115327010) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 5-(5-methylhexylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(5-methylhexylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115327010 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-(5-methylhexylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)CCCCNc1scnc1C(=O)O |
| InChI | InChI=1S/C11H18N2O2S/c1-8(2)5-3-4-6-12-10-9(11(14)15)13-7-16-10/h7-8,12H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | NPEMEZLDNBOAIX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|