C9H14N2O4S — CID 64628892
5-[2-(2-methoxyethoxy)ethylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 64628892) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 5-[2-(2-methoxyethoxy)ethylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[2-(2-methoxyethoxy)ethylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64628892 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 5-[2-(2-methoxyethoxy)ethylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | COCCOCCNc1scnc1C(=O)O |
| InChI | InChI=1S/C9H14N2O4S/c1-14-4-5-15-3-2-10-8-7(9(12)13)11-6-16-8/h6,10H,2-5H2,1H3,(H,12,13) |
| InChIKey | FPGNNFZTOFTYHR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|