C10H12N2O2S — CID 106215466
5-(hex-5-ynylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 106215466) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 5-(hex-5-ynylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(hex-5-ynylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106215466 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 5-(hex-5-ynylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | C#CCCCCNc1scnc1C(=O)O |
| InChI | InChI=1S/C10H12N2O2S/c1-2-3-4-5-6-11-9-8(10(13)14)12-7-15-9/h1,7,11H,3-6H2,(H,13,14) |
| InChIKey | XOVZMPIQXZEKTQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|