C7H10N2O2S — CID 64631089
5-(propylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631089) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 5-(propylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(propylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64631089 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-(propylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCNc1scnc1C(=O)O |
| InChI | InChI=1S/C7H10N2O2S/c1-2-3-8-6-5(7(10)11)9-4-12-6/h4,8H,2-3H2,1H3,(H,10,11) |
| InChIKey | QGXZDICJSKOAMF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |