5-(propylamino)-1,3-thiazole-4-carboxylic acid

C7H10N2O2S — CID 64631089

IUPAC5-(propylamino)-1,3-thiazole-4-carboxylic acid
SMILESCCCNc1scnc1C(=O)O
InChIInChI=1S/C7H10N2O2S/c1-2-3-8-6-5(7(10)11)9-4-12-6/h4,8H,2-3H2,1H3,(H,10,11)
InChIKeyQGXZDICJSKOAMF-UHFFFAOYSA-N
MW186.24 g/mol
LogP1.66
Rot. Bonds4

About 5-(propylamino)-1,3-thiazole-4-carboxylic acid

5-(propylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631089) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 5-(propylamino)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(propylamino)-1,3-thiazole-4-carboxylic acid
PubChem CID64631089
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name5-(propylamino)-1,3-thiazole-4-carboxylic acid
SMILESCCCNc1scnc1C(=O)O
InChIInChI=1S/C7H10N2O2S/c1-2-3-8-6-5(7(10)11)9-4-12-6/h4,8H,2-3H2,1H3,(H,10,11)
InChIKeyQGXZDICJSKOAMF-UHFFFAOYSA-N
XLogP1.66
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(propylamino)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(propylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(propylamino)-1,3-thiazole-4-carboxylic acid (CID 64631089) is 5-(propylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(propylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(propylamino)-1,3-thiazole-4-carboxylic acid is CCCNc1scnc1C(=O)O.
What is the InChIKey of 5-(propylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is QGXZDICJSKOAMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-2-3-8-6-5(7(10)11)9-4-12-6/h4,8H,2-3H2,1H3,(H,10,11).
What are the key properties of 5-(propylamino)-1,3-thiazole-4-carboxylic acid?
5-(propylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 186.24 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(propylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 64631089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).