5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid

C12H12N2O3S — CID 64630076

IUPAC5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid
SMILESCOc1cccc(CNc2scnc2C(=O)O)c1
InChIInChI=1S/C12H12N2O3S/c1-17-9-4-2-3-8(5-9)6-13-11-10(12(15)16)14-7-18-11/h2-5,7,13H,6H2,1H3,(H,15,16)
InChIKeyKYLOHYNJUMCGMA-UHFFFAOYSA-N
MW264.31 g/mol
LogP2.46
Rot. Bonds5

About 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid

5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 64630076) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid
PubChem CID64630076
Molecular FormulaC12H12N2O3S
Molecular Weight264.31 g/mol
Exact Mass264.06
IUPAC Name5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid
SMILESCOc1cccc(CNc2scnc2C(=O)O)c1
InChIInChI=1S/C12H12N2O3S/c1-17-9-4-2-3-8(5-9)6-13-11-10(12(15)16)14-7-18-11/h2-5,7,13H,6H2,1H3,(H,15,16)
InChIKeyKYLOHYNJUMCGMA-UHFFFAOYSA-N
XLogP2.46
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.31
LogP ≤ 52.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid (CID 64630076) is 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid is COc1cccc(CNc2scnc2C(=O)O)c1.
What is the InChIKey of 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is KYLOHYNJUMCGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3S/c1-17-9-4-2-3-8(5-9)6-13-11-10(12(15)16)14-7-18-11/h2-5,7,13H,6H2,1H3,(H,15,16).
What are the key properties of 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid?
5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 264.31 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 64630076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).