4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid

C12H11NO3S — CID 82480528

IUPAC4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid
SMILESCOc1cccc(Cc2ncsc2C(=O)O)c1
InChIInChI=1S/C12H11NO3S/c1-16-9-4-2-3-8(5-9)6-10-11(12(14)15)17-7-13-10/h2-5,7H,6H2,1H3,(H,14,15)
InChIKeyLWTYXXRXVGYSTO-UHFFFAOYSA-N
MW249.29 g/mol
LogP2.44
Rot. Bonds4

About 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid

4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 82480528) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid
PubChem CID82480528
Molecular FormulaC12H11NO3S
Molecular Weight249.29 g/mol
Exact Mass249.05
IUPAC Name4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid
SMILESCOc1cccc(Cc2ncsc2C(=O)O)c1
InChIInChI=1S/C12H11NO3S/c1-16-9-4-2-3-8(5-9)6-10-11(12(14)15)17-7-13-10/h2-5,7H,6H2,1H3,(H,14,15)
InChIKeyLWTYXXRXVGYSTO-UHFFFAOYSA-N
XLogP2.44
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.29
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid (CID 82480528) is 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid is COc1cccc(Cc2ncsc2C(=O)O)c1.
What is the InChIKey of 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is LWTYXXRXVGYSTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3S/c1-16-9-4-2-3-8(5-9)6-10-11(12(14)15)17-7-13-10/h2-5,7H,6H2,1H3,(H,14,15).
What are the key properties of 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid?
4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 249.29 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methoxyphenyl)methyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 82480528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).