C13H22N2O3S — CID 106015850
ethyl 5-(4-propan-2-yloxybutylamino)-1,3-thiazole-4-carboxylate (PubChem CID 106015850) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is ethyl 5-(4-propan-2-yloxybutylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(4-propan-2-yloxybutylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106015850 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 5-(4-propan-2-yloxybutylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1NCCCCOC(C)C |
| InChI | InChI=1S/C13H22N2O3S/c1-4-17-13(16)11-12(19-9-15-11)14-7-5-6-8-18-10(2)3/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | DECDYJLMYNWCKP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|