C14H21BrN2O3 — CID 126820971
ethyl 3-bromo-6-(3-propan-2-yloxypropylamino)pyridine-2-carboxylate (PubChem CID 126820971) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is ethyl 3-bromo-6-(3-propan-2-yloxypropylamino)pyridine-2-carboxylate.
| Compound Name | ethyl 3-bromo-6-(3-propan-2-yloxypropylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 126820971 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | ethyl 3-bromo-6-(3-propan-2-yloxypropylamino)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(NCCCOC(C)C)ccc1Br |
| InChI | InChI=1S/C14H21BrN2O3/c1-4-19-14(18)13-11(15)6-7-12(17-13)16-8-5-9-20-10(2)3/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,17) |
| InChIKey | VUQUCLMSXDIWPK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|