C12H18N2O2S — CID 113479412
ethyl 5-(2-cyclobutylethylamino)-1,3-thiazole-4-carboxylate (PubChem CID 113479412) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is ethyl 5-(2-cyclobutylethylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(2-cyclobutylethylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 113479412 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethyl 5-(2-cyclobutylethylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1NCCC1CCC1 |
| InChI | InChI=1S/C12H18N2O2S/c1-2-16-12(15)10-11(17-8-14-10)13-7-6-9-4-3-5-9/h8-9,13H,2-7H2,1H3 |
| InChIKey | SOIRHUDSFMMIQW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |