C10H14N2O2S2 — CID 103064920
ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate (PubChem CID 103064920) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103064920 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1NC1CCSC1 |
| InChI | InChI=1S/C10H14N2O2S2/c1-2-14-10(13)8-9(16-6-11-8)12-7-3-4-15-5-7/h6-7,12H,2-5H2,1H3 |
| InChIKey | ZTOIGIPKYXWTEE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |