About ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate
ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate (PubChem CID 103064920) has the molecular formula C10H14N2O2S2
and a molecular weight of 258.37 g/mol. Its IUPAC name is ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate |
| PubChem CID | 103064920 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1NC1CCSC1 |
| InChI | InChI=1S/C10H14N2O2S2/c1-2-14-10(13)8-9(16-6-11-8)12-7-3-4-15-5-7/h6-7,12H,2-5H2,1H3 |
| InChIKey | ZTOIGIPKYXWTEE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate (CID 103064920) is ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate is CCOC(=O)c1ncsc1NC1CCSC1.
What is the InChIKey of ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate?
The InChIKey is ZTOIGIPKYXWTEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S2/c1-2-14-10(13)8-9(16-6-11-8)12-7-3-4-15-5-7/h6-7,12H,2-5H2,1H3.
What are the key properties of ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate?
ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate has a molecular weight of 258.37 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(thiolan-3-ylamino)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 103064920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).