C9H12N2O4S3 — CID 113451646
methyl 5-(thiolan-3-ylsulfamoyl)-1,3-thiazole-4-carboxylate (PubChem CID 113451646) has the molecular formula C9H12N2O4S3 and a molecular weight of 308.41 g/mol. Its IUPAC name is methyl 5-(thiolan-3-ylsulfamoyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-(thiolan-3-ylsulfamoyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 113451646 |
| Molecular Formula | C9H12N2O4S3 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | methyl 5-(thiolan-3-ylsulfamoyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)NC1CCSC1 |
| InChI | InChI=1S/C9H12N2O4S3/c1-15-8(12)7-9(17-5-10-7)18(13,14)11-6-2-3-16-4-6/h5-6,11H,2-4H2,1H3 |
| InChIKey | WCNMXQSPECYIDQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |