C12H14FNO4S2 — CID 103836299
methyl 4-fluoro-2-(thiolan-3-ylsulfamoyl)benzoate (PubChem CID 103836299) has the molecular formula C12H14FNO4S2 and a molecular weight of 319.38 g/mol. Its IUPAC name is methyl 4-fluoro-2-(thiolan-3-ylsulfamoyl)benzoate.
| Compound Name | methyl 4-fluoro-2-(thiolan-3-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 103836299 |
| Molecular Formula | C12H14FNO4S2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | methyl 4-fluoro-2-(thiolan-3-ylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(F)cc1S(=O)(=O)NC1CCSC1 |
| InChI | InChI=1S/C12H14FNO4S2/c1-18-12(15)10-3-2-8(13)6-11(10)20(16,17)14-9-4-5-19-7-9/h2-3,6,9,14H,4-5,7H2,1H3 |
| InChIKey | XXXBCMJKVLZAKE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |