C11H11FN2O6S — CID 102919579
methyl 4-fluoro-2-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoate (PubChem CID 102919579) has the molecular formula C11H11FN2O6S and a molecular weight of 318.28 g/mol. Its IUPAC name is methyl 4-fluoro-2-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoate.
| Compound Name | methyl 4-fluoro-2-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 102919579 |
| Molecular Formula | C11H11FN2O6S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | methyl 4-fluoro-2-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(F)cc1S(=O)(=O)N[C@@H]1CONC1=O |
| InChI | InChI=1S/C11H11FN2O6S/c1-19-11(16)7-3-2-6(12)4-9(7)21(17,18)14-8-5-20-13-10(8)15/h2-4,8,14H,5H2,1H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | UQSLYKOWDYFAPV-MRVPVSSYSA-N |
| XLogP | -0.68 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |