C17H18N2O4S2 — CID 99715732
methyl 5-[[(1S,3aS)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]sulfamoyl]-1,3-thiazole-4-carboxylate (PubChem CID 99715732) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is methyl 5-[[(1S,3aS)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]sulfamoyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-[[(1S,3aS)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]sulfamoyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 99715732 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | methyl 5-[[(1S,3aS)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]sulfamoyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)N[C@H]1C[C@@H]2CCCc3cccc1c32 |
| InChI | InChI=1S/C17H18N2O4S2/c1-23-16(20)15-17(24-9-18-15)25(21,22)19-13-8-11-6-2-4-10-5-3-7-12(13)14(10)11/h3,5,7,9,11,13,19H,2,4,6,8H2,1H3/t11-,13-/m0/s1 |
| InChIKey | RHPMRRLJDGHEIL-AAEUAGOBSA-N |
| XLogP | 2.77 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |