C11H10BrN3O4S2 — CID 104952560
methyl 5-[(6-bromo-5-methyl-3-pyridinyl)sulfamoyl]-1,3-thiazole-4-carboxylate (PubChem CID 104952560) has the molecular formula C11H10BrN3O4S2 and a molecular weight of 392.26 g/mol. Its IUPAC name is methyl 5-[(6-bromo-5-methyl-3-pyridinyl)sulfamoyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-[(6-bromo-5-methyl-3-pyridinyl)sulfamoyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 104952560 |
| Molecular Formula | C11H10BrN3O4S2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | methyl 5-[(6-bromo-5-methyl-3-pyridinyl)sulfamoyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)Nc1cnc(Br)c(C)c1 |
| InChI | InChI=1S/C11H10BrN3O4S2/c1-6-3-7(4-13-9(6)12)15-21(17,18)11-8(10(16)19-2)14-5-20-11/h3-5,15H,1-2H3 |
| InChIKey | YLICEWSNDYGJMO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|