C11H8ClIN2O4S2 — CID 107624866
methyl 5-[(4-chloro-2-iodophenyl)sulfamoyl]-1,3-thiazole-4-carboxylate (PubChem CID 107624866) has the molecular formula C11H8ClIN2O4S2 and a molecular weight of 458.69 g/mol. Its IUPAC name is methyl 5-[(4-chloro-2-iodophenyl)sulfamoyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-[(4-chloro-2-iodophenyl)sulfamoyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 107624866 |
| Molecular Formula | C11H8ClIN2O4S2 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 457.87 |
| IUPAC Name | methyl 5-[(4-chloro-2-iodophenyl)sulfamoyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)Nc1ccc(Cl)cc1I |
| InChI | InChI=1S/C11H8ClIN2O4S2/c1-19-10(16)9-11(20-5-14-9)21(17,18)15-8-3-2-6(12)4-7(8)13/h2-5,15H,1H3 |
| InChIKey | CAWSXFPIPXOGBD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|