C11H18N2O5S2 — CID 104773163
methyl 5-(6-hydroxyhexylsulfamoyl)-1,3-thiazole-4-carboxylate (PubChem CID 104773163) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 5-(6-hydroxyhexylsulfamoyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-(6-hydroxyhexylsulfamoyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 104773163 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl 5-(6-hydroxyhexylsulfamoyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)NCCCCCCO |
| InChI | InChI=1S/C11H18N2O5S2/c1-18-10(15)9-11(19-8-12-9)20(16,17)13-6-4-2-3-5-7-14/h8,13-14H,2-7H2,1H3 |
| InChIKey | HVCUXHVNZUUPRW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|