C18H26N2O3 — CID 110024207
1-(1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl)-3-[3-(2-hydroxyethoxy)propyl]urea (PubChem CID 110024207) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl)-3-[3-(2-hydroxyethoxy)propyl]urea.
| Compound Name | 1-(1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl)-3-[3-(2-hydroxyethoxy)propyl]urea |
|---|---|
| PubChem CID | 110024207 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-(1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl)-3-[3-(2-hydroxyethoxy)propyl]urea |
| SMILES | O=C(NCCCOCCO)NC1CC2CCCc3cccc1c32 |
| InChI | InChI=1S/C18H26N2O3/c21-9-11-23-10-3-8-19-18(22)20-16-12-14-6-1-4-13-5-2-7-15(16)17(13)14/h2,5,7,14,16,21H,1,3-4,6,8-12H2,(H2,19,20,22) |
| InChIKey | INRGBDMNYQZNQV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|