C18H26N2O4 — CID 122002145
4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoylamino]butanoic acid (PubChem CID 122002145) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoylamino]butanoic acid.
| Compound Name | 4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122002145 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCCCOC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H26N2O4/c21-17(22)10-4-11-19-18(23)20-12-5-13-24-16-9-3-7-14-6-1-2-8-15(14)16/h1-2,6,8,16H,3-5,7,9-13H2,(H,21,22)(H2,19,20,23) |
| InChIKey | XSIDYAFYCWYTIH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|