C21H29NO4 — CID 120673678
4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120673678) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673678 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 4-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCCOC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C21H29NO4/c23-20(16-9-11-17(12-10-16)21(24)25)22-13-4-14-26-19-8-3-6-15-5-1-2-7-18(15)19/h1-2,5,7,16-17,19H,3-4,6,8-14H2,(H,22,23)(H,24,25) |
| InChIKey | IQRXCFYXCMNHHP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|