C18H27NO4 — CID 95378094
2-(2-methoxyethoxy)-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]acetamide (PubChem CID 95378094) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]acetamide |
|---|---|
| PubChem CID | 95378094 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-[3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]acetamide |
| SMILES | COCCOCC(=O)NCCCO[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C18H27NO4/c1-21-12-13-22-14-18(20)19-10-5-11-23-17-9-4-7-15-6-2-3-8-16(15)17/h2-3,6,8,17H,4-5,7,9-14H2,1H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | UWXJWBPRTJIVAR-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|