C17H26N2O3 — CID 95906107
1-[(2R)-1-hydroxypropan-2-yl]-3-[3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]urea (PubChem CID 95906107) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxypropan-2-yl]-3-[3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]urea.
| Compound Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]urea |
|---|---|
| PubChem CID | 95906107 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]urea |
| SMILES | C[C@H](CO)NC(=O)NCCCO[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C17H26N2O3/c1-13(12-20)19-17(21)18-10-5-11-22-16-9-4-7-14-6-2-3-8-15(14)16/h2-3,6,8,13,16,20H,4-5,7,9-12H2,1H3,(H2,18,19,21)/t13-,16+/m1/s1 |
| InChIKey | WVEPKKTYMSJPEF-CJNGLKHVSA-N |
| XLogP | 2.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|