C20H31ClN2O3 — CID 119787364
4-methoxy-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119787364) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is 4-methoxy-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-methoxy-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119787364 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-methoxy-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)NCCCOC2CCCc3ccccc32)CCNCC1.Cl |
| InChI | InChI=1S/C20H30N2O3.ClH/c1-24-20(10-13-21-14-11-20)19(23)22-12-5-15-25-18-9-4-7-16-6-2-3-8-17(16)18;/h2-3,6,8,18,21H,4-5,7,9-15H2,1H3,(H,22,23);1H |
| InChIKey | JMEUGWLLQMZLQI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|