C19H31ClN2O2 — CID 119787376
2-amino-2-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]pentanamide;hydrochloride (PubChem CID 119787376) has the molecular formula C19H31ClN2O2 and a molecular weight of 354.92 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-2-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119787376 |
| Molecular Formula | C19H31ClN2O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2-amino-2-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]pentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NCCCOC1CCCc2ccccc21.Cl |
| InChI | InChI=1S/C19H30N2O2.ClH/c1-3-12-19(2,20)18(22)21-13-7-14-23-17-11-6-9-15-8-4-5-10-16(15)17;/h4-5,8,10,17H,3,6-7,9,11-14,20H2,1-2H3,(H,21,22);1H |
| InChIKey | MUMAIOBIUXMXMA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|