C20H28N2O3 — CID 100603812
(3R)-N-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide (PubChem CID 100603812) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (3R)-N-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide.
| Compound Name | (3R)-N-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 100603812 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (3R)-N-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide |
| SMILES | C[C@H](O)C[C@@H]1COCCN1C(=O)N[C@@H]1C[C@H]2CCCc3cccc1c32 |
| InChI | InChI=1S/C20H28N2O3/c1-13(23)10-16-12-25-9-8-22(16)20(24)21-18-11-15-6-2-4-14-5-3-7-17(18)19(14)15/h3,5,7,13,15-16,18,23H,2,4,6,8-12H2,1H3,(H,21,24)/t13-,15+,16+,18+/m0/s1 |
| InChIKey | XTWNSSLULCMLMZ-AAJLLMFJSA-N |
| XLogP | 2.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |