C19H26N2O2 — CID 99792986
1-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[[(1R,3S)-3-hydroxycyclopentyl]methyl]urea (PubChem CID 99792986) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[[(1R,3S)-3-hydroxycyclopentyl]methyl]urea.
| Compound Name | 1-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[[(1R,3S)-3-hydroxycyclopentyl]methyl]urea |
|---|---|
| PubChem CID | 99792986 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[(1R,3aR)-1,2,3,3a,4,5-hexahydroacenaphthylen-1-yl]-3-[[(1R,3S)-3-hydroxycyclopentyl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CC[C@H](O)C1)N[C@@H]1C[C@H]2CCCc3cccc1c32 |
| InChI | InChI=1S/C19H26N2O2/c22-15-8-7-12(9-15)11-20-19(23)21-17-10-14-5-1-3-13-4-2-6-16(17)18(13)14/h2,4,6,12,14-15,17,22H,1,3,5,7-11H2,(H2,20,21,23)/t12-,14-,15+,17-/m1/s1 |
| InChIKey | KGSNLGDDDSXTSN-JJAZEVLHSA-N |
| XLogP | 3.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |