C12H15BrN2O2 — CID 103279976
6-bromo-N-[(3-hydroxycyclopentyl)methyl]pyridine-2-carboxamide (PubChem CID 103279976) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 6-bromo-N-[(3-hydroxycyclopentyl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[(3-hydroxycyclopentyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103279976 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 6-bromo-N-[(3-hydroxycyclopentyl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCC1CCC(O)C1)c1cccc(Br)n1 |
| InChI | InChI=1S/C12H15BrN2O2/c13-11-3-1-2-10(15-11)12(17)14-7-8-4-5-9(16)6-8/h1-3,8-9,16H,4-7H2,(H,14,17) |
| InChIKey | BMGSPSIVSKNLBU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|