C13H17BrN2O2 — CID 113351463
6-bromo-N-[(2-hydroxycyclohexyl)methyl]pyridine-2-carboxamide (PubChem CID 113351463) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 6-bromo-N-[(2-hydroxycyclohexyl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[(2-hydroxycyclohexyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113351463 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 6-bromo-N-[(2-hydroxycyclohexyl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1O)c1cccc(Br)n1 |
| InChI | InChI=1S/C13H17BrN2O2/c14-12-7-3-5-10(16-12)13(18)15-8-9-4-1-2-6-11(9)17/h3,5,7,9,11,17H,1-2,4,6,8H2,(H,15,18) |
| InChIKey | AMHWHEJMVIVUGV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|