C14H15BrN2O — CID 103916993
6-bromo-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-2-carboxamide (PubChem CID 103916993) has the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. Its IUPAC name is 6-bromo-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103916993 |
| Molecular Formula | C14H15BrN2O |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 6-bromo-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-2-carboxamide |
| SMILES | O=C(NC1C2C3CCC(C3)C12)c1cccc(Br)n1 |
| InChI | InChI=1S/C14H15BrN2O/c15-10-3-1-2-9(16-10)14(18)17-13-11-7-4-5-8(6-7)12(11)13/h1-3,7-8,11-13H,4-6H2,(H,17,18) |
| InChIKey | DIXSGNAYQTXQNQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|