C14H21ClN2O3S — CID 99636601
(3S)-N-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide (PubChem CID 99636601) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is (3S)-N-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide.
| Compound Name | (3S)-N-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 99636601 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (3S)-N-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-2-hydroxypropyl]morpholine-4-carboxamide |
| SMILES | C[C@H](O)C[C@H]1COCCN1C(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-10(18)8-11-9-20-7-6-17(11)14(19)16-5-4-12-2-3-13(15)21-12/h2-3,10-11,18H,4-9H2,1H3,(H,16,19)/t10-,11-/m0/s1 |
| InChIKey | BRUWAYXIEBPWLE-QWRGUYRKSA-N |
| XLogP | 2.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |