C18H29ClN2O3S — CID 113477378
tert-butyl 3-[2-[2-(5-chlorothiophen-2-yl)ethylamino]propyl]morpholine-4-carboxylate (PubChem CID 113477378) has the molecular formula C18H29ClN2O3S and a molecular weight of 388.96 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-(5-chlorothiophen-2-yl)ethylamino]propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-(5-chlorothiophen-2-yl)ethylamino]propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 113477378 |
| Molecular Formula | C18H29ClN2O3S |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | tert-butyl 3-[2-[2-(5-chlorothiophen-2-yl)ethylamino]propyl]morpholine-4-carboxylate |
| SMILES | CC(CC1COCCN1C(=O)OC(C)(C)C)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C18H29ClN2O3S/c1-13(20-8-7-15-5-6-16(19)25-15)11-14-12-23-10-9-21(14)17(22)24-18(2,3)4/h5-6,13-14,20H,7-12H2,1-4H3 |
| InChIKey | QBWSDPGMPDDGDJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |