C16H32N2O4 — CID 104855310
tert-butyl 3-[2-[(2-hydroxy-2-methylpropyl)amino]propyl]morpholine-4-carboxylate (PubChem CID 104855310) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is tert-butyl 3-[2-[(2-hydroxy-2-methylpropyl)amino]propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-[(2-hydroxy-2-methylpropyl)amino]propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 104855310 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | tert-butyl 3-[2-[(2-hydroxy-2-methylpropyl)amino]propyl]morpholine-4-carboxylate |
| SMILES | CC(CC1COCCN1C(=O)OC(C)(C)C)NCC(C)(C)O |
| InChI | InChI=1S/C16H32N2O4/c1-12(17-11-16(5,6)20)9-13-10-21-8-7-18(13)14(19)22-15(2,3)4/h12-13,17,20H,7-11H2,1-6H3 |
| InChIKey | DLBCCQRUUQEVIW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |