C17H35N3O3 — CID 104855230
tert-butyl 3-[2-[3-(dimethylamino)propylamino]propyl]morpholine-4-carboxylate (PubChem CID 104855230) has the molecular formula C17H35N3O3 and a molecular weight of 329.49 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-(dimethylamino)propylamino]propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-[3-(dimethylamino)propylamino]propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 104855230 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | tert-butyl 3-[2-[3-(dimethylamino)propylamino]propyl]morpholine-4-carboxylate |
| SMILES | CC(CC1COCCN1C(=O)OC(C)(C)C)NCCCN(C)C |
| InChI | InChI=1S/C17H35N3O3/c1-14(18-8-7-9-19(5)6)12-15-13-22-11-10-20(15)16(21)23-17(2,3)4/h14-15,18H,7-13H2,1-6H3 |
| InChIKey | AIBYBNMSRSWZDO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|