C17H34N2O3S — CID 104866010
tert-butyl 3-[2-(4-methylsulfanylbutylamino)propyl]morpholine-4-carboxylate (PubChem CID 104866010) has the molecular formula C17H34N2O3S and a molecular weight of 346.54 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-methylsulfanylbutylamino)propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-methylsulfanylbutylamino)propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 104866010 |
| Molecular Formula | C17H34N2O3S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl 3-[2-(4-methylsulfanylbutylamino)propyl]morpholine-4-carboxylate |
| SMILES | CSCCCCNC(C)CC1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34N2O3S/c1-14(18-8-6-7-11-23-5)12-15-13-21-10-9-19(15)16(20)22-17(2,3)4/h14-15,18H,6-13H2,1-5H3 |
| InChIKey | SUTJYXITSBXKAA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|