C15H29N3O5 — CID 104855381
tert-butyl 3-[2-(2-carbamoyloxyethylamino)propyl]morpholine-4-carboxylate (PubChem CID 104855381) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is tert-butyl 3-[2-(2-carbamoyloxyethylamino)propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(2-carbamoyloxyethylamino)propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 104855381 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl 3-[2-(2-carbamoyloxyethylamino)propyl]morpholine-4-carboxylate |
| SMILES | CC(CC1COCCN1C(=O)OC(C)(C)C)NCCOC(N)=O |
| InChI | InChI=1S/C15H29N3O5/c1-11(17-5-7-22-13(16)19)9-12-10-21-8-6-18(12)14(20)23-15(2,3)4/h11-12,17H,5-10H2,1-4H3,(H2,16,19) |
| InChIKey | APNJUQWYLDJQQO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|