C10H21ClN2O3 — CID 84819306
tert-butyl (3S)-3-(aminomethyl)morpholine-4-carboxylate;hydrochloride (PubChem CID 84819306) has the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. Its IUPAC name is tert-butyl (3S)-3-(aminomethyl)morpholine-4-carboxylate;hydrochloride.
| Compound Name | tert-butyl (3S)-3-(aminomethyl)morpholine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 84819306 |
| Molecular Formula | C10H21ClN2O3 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | tert-butyl (3S)-3-(aminomethyl)morpholine-4-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1CN.Cl |
| InChI | InChI=1S/C10H20N2O3.ClH/c1-10(2,3)15-9(13)12-4-5-14-7-8(12)6-11;/h8H,4-7,11H2,1-3H3;1H/t8-;/m0./s1 |
| InChIKey | YDSFWBOOABKQEE-QRPNPIFTSA-N |
| XLogP | 1.00 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |