C18H25NO4 — CID 104855099
tert-butyl 3-[2-(4-methylphenyl)-2-oxoethyl]morpholine-4-carboxylate (PubChem CID 104855099) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-methylphenyl)-2-oxoethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-methylphenyl)-2-oxoethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 104855099 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl 3-[2-(4-methylphenyl)-2-oxoethyl]morpholine-4-carboxylate |
| SMILES | Cc1ccc(C(=O)CC2COCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-13-5-7-14(8-6-13)16(20)11-15-12-22-10-9-19(15)17(21)23-18(2,3)4/h5-8,15H,9-12H2,1-4H3 |
| InChIKey | VFYATXLDMJXYNF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |